C19H13Cl2NO3 — CID 1108271
N-(3,4-dichlorophenyl)-2-oxo-8-prop-2-enylchromene-3-carboxamide (PubChem CID 1108271) has the molecular formula C19H13Cl2NO3 and a molecular weight of 374.22 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-oxo-8-prop-2-enylchromene-3-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-2-oxo-8-prop-2-enylchromene-3-carboxamide |
|---|---|
| PubChem CID | 1108271 |
| Molecular Formula | C19H13Cl2NO3 |
| Molecular Weight | 374.22 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-oxo-8-prop-2-enylchromene-3-carboxamide |
| SMILES | C=CCc1cccc2cc(C(=O)Nc3ccc(Cl)c(Cl)c3)c(=O)oc12 |
| InChI | InChI=1S/C19H13Cl2NO3/c1-2-4-11-5-3-6-12-9-14(19(24)25-17(11)12)18(23)22-13-7-8-15(20)16(21)10-13/h2-3,5-10H,1,4H2,(H,22,23) |
| InChIKey | VUIAHTSDMQMKJN-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.22 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'coumarin_B(2)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|