C19H14BrNO3 — CID 611701
N-(2-bromophenyl)-2-oxo-8-prop-2-enylchromene-3-carboxamide (PubChem CID 611701) has the molecular formula C19H14BrNO3 and a molecular weight of 384.23 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-oxo-8-prop-2-enylchromene-3-carboxamide.
| Compound Name | N-(2-bromophenyl)-2-oxo-8-prop-2-enylchromene-3-carboxamide |
|---|---|
| PubChem CID | 611701 |
| Molecular Formula | C19H14BrNO3 |
| Molecular Weight | 384.23 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | N-(2-bromophenyl)-2-oxo-8-prop-2-enylchromene-3-carboxamide |
| SMILES | C=CCc1cccc2cc(C(=O)Nc3ccccc3Br)c(=O)oc12 |
| InChI | InChI=1S/C19H14BrNO3/c1-2-6-12-7-5-8-13-11-14(19(23)24-17(12)13)18(22)21-16-10-4-3-9-15(16)20/h2-5,7-11H,1,6H2,(H,21,22) |
| InChIKey | FMRHXIGDTFESRE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.23 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'coumarin_B(2)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|