C19H15N3O4 — CID 785049
N'-(2-oxo-8-prop-2-enylchromene-3-carbonyl)pyridine-4-carbohydrazide (PubChem CID 785049) has the molecular formula C19H15N3O4 and a molecular weight of 349.35 g/mol. Its IUPAC name is N'-(2-oxo-8-prop-2-enylchromene-3-carbonyl)pyridine-4-carbohydrazide.
| Compound Name | N'-(2-oxo-8-prop-2-enylchromene-3-carbonyl)pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 785049 |
| Molecular Formula | C19H15N3O4 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | N'-(2-oxo-8-prop-2-enylchromene-3-carbonyl)pyridine-4-carbohydrazide |
| SMILES | C=CCc1cccc2cc(C(=O)NNC(=O)c3ccncc3)c(=O)oc12 |
| InChI | InChI=1S/C19H15N3O4/c1-2-4-12-5-3-6-14-11-15(19(25)26-16(12)14)18(24)22-21-17(23)13-7-9-20-10-8-13/h2-3,5-11H,1,4H2,(H,21,23)(H,22,24) |
| InChIKey | FWWDDDPKBMQTIF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|