C20H25N2O4+ — CID 2254975
N-(3-morpholin-4-ium-4-ylpropyl)-2-oxo-8-prop-2-enylchromene-3-carboxamide (PubChem CID 2254975) has the molecular formula C20H25N2O4+ and a molecular weight of 357.43 g/mol. Its IUPAC name is N-(3-morpholin-4-ium-4-ylpropyl)-2-oxo-8-prop-2-enylchromene-3-carboxamide.
| Compound Name | N-(3-morpholin-4-ium-4-ylpropyl)-2-oxo-8-prop-2-enylchromene-3-carboxamide |
|---|---|
| PubChem CID | 2254975 |
| Molecular Formula | C20H25N2O4+ |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | N-(3-morpholin-4-ium-4-ylpropyl)-2-oxo-8-prop-2-enylchromene-3-carboxamide |
| SMILES | C=CCc1cccc2cc(C(=O)NCCC[NH+]3CCOCC3)c(=O)oc12 |
| InChI | InChI=1S/C20H24N2O4/c1-2-5-15-6-3-7-16-14-17(20(24)26-18(15)16)19(23)21-8-4-9-22-10-12-25-13-11-22/h2-3,6-7,14H,1,4-5,8-13H2,(H,21,23)/p+1 |
| InChIKey | RHLOJTZSQDLBGE-UHFFFAOYSA-O |
| XLogP | 0.56 |
| TPSA | 72.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|