C19H15NO4 — CID 804653
N-(3-hydroxyphenyl)-2-oxo-8-prop-2-enylchromene-3-carboxamide (PubChem CID 804653) has the molecular formula C19H15NO4 and a molecular weight of 321.33 g/mol. Its IUPAC name is N-(3-hydroxyphenyl)-2-oxo-8-prop-2-enylchromene-3-carboxamide.
| Compound Name | N-(3-hydroxyphenyl)-2-oxo-8-prop-2-enylchromene-3-carboxamide |
|---|---|
| PubChem CID | 804653 |
| Molecular Formula | C19H15NO4 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | N-(3-hydroxyphenyl)-2-oxo-8-prop-2-enylchromene-3-carboxamide |
| SMILES | C=CCc1cccc2cc(C(=O)Nc3cccc(O)c3)c(=O)oc12 |
| InChI | InChI=1S/C19H15NO4/c1-2-5-12-6-3-7-13-10-16(19(23)24-17(12)13)18(22)20-14-8-4-9-15(21)11-14/h2-4,6-11,21H,1,5H2,(H,20,22) |
| InChIKey | JBGXXDWXEVGUIX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'coumarin_B(2)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|