C15H12N4O3 — CID 21176516
2-oxo-8-prop-2-enyl-N-(1,2,4-triazol-4-yl)chromene-3-carboxamide (PubChem CID 21176516) has the molecular formula C15H12N4O3 and a molecular weight of 296.29 g/mol. Its IUPAC name is 2-oxo-8-prop-2-enyl-N-(1,2,4-triazol-4-yl)chromene-3-carboxamide.
| Compound Name | 2-oxo-8-prop-2-enyl-N-(1,2,4-triazol-4-yl)chromene-3-carboxamide |
|---|---|
| PubChem CID | 21176516 |
| Molecular Formula | C15H12N4O3 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 2-oxo-8-prop-2-enyl-N-(1,2,4-triazol-4-yl)chromene-3-carboxamide |
| SMILES | C=CCc1cccc2cc(C(=O)Nn3cnnc3)c(=O)oc12 |
| InChI | InChI=1S/C15H12N4O3/c1-2-4-10-5-3-6-11-7-12(15(21)22-13(10)11)14(20)18-19-8-16-17-9-19/h2-3,5-9H,1,4H2,(H,18,20) |
| InChIKey | IGXVMKHTZUWGCB-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|