C20H16N2O5 — CID 2888714
N-(4-methyl-2-nitrophenyl)-2-oxo-8-prop-2-enylchromene-3-carboxamide (PubChem CID 2888714) has the molecular formula C20H16N2O5 and a molecular weight of 364.36 g/mol. Its IUPAC name is N-(4-methyl-2-nitrophenyl)-2-oxo-8-prop-2-enylchromene-3-carboxamide.
| Compound Name | N-(4-methyl-2-nitrophenyl)-2-oxo-8-prop-2-enylchromene-3-carboxamide |
|---|---|
| PubChem CID | 2888714 |
| Molecular Formula | C20H16N2O5 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | N-(4-methyl-2-nitrophenyl)-2-oxo-8-prop-2-enylchromene-3-carboxamide |
| SMILES | C=CCc1cccc2cc(C(=O)Nc3ccc(C)cc3[N+](=O)[O-])c(=O)oc12 |
| InChI | InChI=1S/C20H16N2O5/c1-3-5-13-6-4-7-14-11-15(20(24)27-18(13)14)19(23)21-16-9-8-12(2)10-17(16)22(25)26/h3-4,6-11H,1,5H2,2H3,(H,21,23) |
| InChIKey | SUPQWYCRFNECAV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 102.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'coumarin_B(2)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|