C22H20N2O6 — CID 1122732
N'-(3,4-dimethoxybenzoyl)-2-oxo-8-prop-2-enylchromene-3-carbohydrazide (PubChem CID 1122732) has the molecular formula C22H20N2O6 and a molecular weight of 408.41 g/mol. Its IUPAC name is N'-(3,4-dimethoxybenzoyl)-2-oxo-8-prop-2-enylchromene-3-carbohydrazide.
| Compound Name | N'-(3,4-dimethoxybenzoyl)-2-oxo-8-prop-2-enylchromene-3-carbohydrazide |
|---|---|
| PubChem CID | 1122732 |
| Molecular Formula | C22H20N2O6 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | N'-(3,4-dimethoxybenzoyl)-2-oxo-8-prop-2-enylchromene-3-carbohydrazide |
| SMILES | C=CCc1cccc2cc(C(=O)NNC(=O)c3ccc(OC)c(OC)c3)c(=O)oc12 |
| InChI | InChI=1S/C22H20N2O6/c1-4-6-13-7-5-8-14-11-16(22(27)30-19(13)14)21(26)24-23-20(25)15-9-10-17(28-2)18(12-15)29-3/h4-5,7-12H,1,6H2,2-3H3,(H,23,25)(H,24,26) |
| InChIKey | ALFKJCUJBZFDKE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|