C19H17NO3 — CID 100794377
N-(2,6-dimethylphenyl)-6-methyl-2-oxochromene-3-carboxamide (PubChem CID 100794377) has the molecular formula C19H17NO3 and a molecular weight of 307.35 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-6-methyl-2-oxochromene-3-carboxamide.
| Compound Name | N-(2,6-dimethylphenyl)-6-methyl-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 100794377 |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | N-(2,6-dimethylphenyl)-6-methyl-2-oxochromene-3-carboxamide |
| SMILES | Cc1ccc2oc(=O)c(C(=O)Nc3c(C)cccc3C)cc2c1 |
| InChI | InChI=1S/C19H17NO3/c1-11-7-8-16-14(9-11)10-15(19(22)23-16)18(21)20-17-12(2)5-4-6-13(17)3/h4-10H,1-3H3,(H,20,21) |
| InChIKey | LRUACKBLVXFICN-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|