C15H13NO4 — CID 16573543
N-(1,3-benzodioxol-5-yl)-2-hydroxy-5-methylbenzamide (PubChem CID 16573543) has the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-hydroxy-5-methylbenzamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-hydroxy-5-methylbenzamide |
|---|---|
| PubChem CID | 16573543 |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-hydroxy-5-methylbenzamide |
| SMILES | Cc1ccc(O)c(C(=O)Nc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C15H13NO4/c1-9-2-4-12(17)11(6-9)15(18)16-10-3-5-13-14(7-10)20-8-19-13/h2-7,17H,8H2,1H3,(H,16,18) |
| InChIKey | HPBMLZQQRVOIHE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |