C21H17ClN2O5S — CID 92679696
N-(1,3-benzodioxol-5-yl)-2-chloro-4-[(4-methylphenyl)sulfonylamino]benzamide (PubChem CID 92679696) has the molecular formula C21H17ClN2O5S and a molecular weight of 444.90 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-chloro-4-[(4-methylphenyl)sulfonylamino]benzamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-chloro-4-[(4-methylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 92679696 |
| Molecular Formula | C21H17ClN2O5S |
| Molecular Weight | 444.90 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-chloro-4-[(4-methylphenyl)sulfonylamino]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(C(=O)Nc3ccc4c(c3)OCO4)c(Cl)c2)cc1 |
| InChI | InChI=1S/C21H17ClN2O5S/c1-13-2-6-16(7-3-13)30(26,27)24-15-4-8-17(18(22)10-15)21(25)23-14-5-9-19-20(11-14)29-12-28-19/h2-11,24H,12H2,1H3,(H,23,25) |
| InChIKey | SBJUNGAUCVJDDF-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.90 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |