C23H15N3O8 — CID 3814558
N-[3-methoxy-4-(2-oxochromen-3-yl)phenyl]-2,4-dinitrobenzamide (PubChem CID 3814558) has the molecular formula C23H15N3O8 and a molecular weight of 461.39 g/mol. Its IUPAC name is N-[3-methoxy-4-(2-oxochromen-3-yl)phenyl]-2,4-dinitrobenzamide.
| Compound Name | N-[3-methoxy-4-(2-oxochromen-3-yl)phenyl]-2,4-dinitrobenzamide |
|---|---|
| PubChem CID | 3814558 |
| Molecular Formula | C23H15N3O8 |
| Molecular Weight | 461.39 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | N-[3-methoxy-4-(2-oxochromen-3-yl)phenyl]-2,4-dinitrobenzamide |
| SMILES | COc1cc(NC(=O)c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])ccc1-c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C23H15N3O8/c1-33-21-11-14(24-22(27)17-9-7-15(25(29)30)12-19(17)26(31)32)6-8-16(21)18-10-13-4-2-3-5-20(13)34-23(18)28/h2-12H,1H3,(H,24,27) |
| InChIKey | ONESCYJDURWNEY-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 154.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.39 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|