C24H18N2O5S — CID 87482746
N-[[3-methoxy-4-(2-oxochromen-3-yl)phenyl]carbamoyl]-N-sulfanylbenzamide (PubChem CID 87482746) has the molecular formula C24H18N2O5S and a molecular weight of 446.48 g/mol. Its IUPAC name is N-[[3-methoxy-4-(2-oxochromen-3-yl)phenyl]carbamoyl]-N-sulfanylbenzamide.
| Compound Name | N-[[3-methoxy-4-(2-oxochromen-3-yl)phenyl]carbamoyl]-N-sulfanylbenzamide |
|---|---|
| PubChem CID | 87482746 |
| Molecular Formula | C24H18N2O5S |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | N-[[3-methoxy-4-(2-oxochromen-3-yl)phenyl]carbamoyl]-N-sulfanylbenzamide |
| SMILES | COc1cc(NC(=O)N(S)C(=O)c2ccccc2)ccc1-c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C24H18N2O5S/c1-30-21-14-17(25-24(29)26(32)22(27)15-7-3-2-4-8-15)11-12-18(21)19-13-16-9-5-6-10-20(16)31-23(19)28/h2-14,32H,1H3,(H,25,29) |
| InChIKey | JUNWYMSDUCNKKJ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|