C25H19Cl2NO5 — CID 26020802
(2R)-2-(2,4-dichlorophenoxy)-N-[3-methoxy-4-(2-oxochromen-3-yl)phenyl]propanamide (PubChem CID 26020802) has the molecular formula C25H19Cl2NO5 and a molecular weight of 484.34 g/mol. Its IUPAC name is (2R)-2-(2,4-dichlorophenoxy)-N-[3-methoxy-4-(2-oxochromen-3-yl)phenyl]propanamide.
| Compound Name | (2R)-2-(2,4-dichlorophenoxy)-N-[3-methoxy-4-(2-oxochromen-3-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 26020802 |
| Molecular Formula | C25H19Cl2NO5 |
| Molecular Weight | 484.34 g/mol |
| Exact Mass | 483.06 |
| IUPAC Name | (2R)-2-(2,4-dichlorophenoxy)-N-[3-methoxy-4-(2-oxochromen-3-yl)phenyl]propanamide |
| SMILES | COc1cc(NC(=O)[C@@H](C)Oc2ccc(Cl)cc2Cl)ccc1-c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C25H19Cl2NO5/c1-14(32-22-10-7-16(26)12-20(22)27)24(29)28-17-8-9-18(23(13-17)31-2)19-11-15-5-3-4-6-21(15)33-25(19)30/h3-14H,1-2H3,(H,28,29)/t14-/m1/s1 |
| InChIKey | OXDZWBLXWRAVMU-CQSZACIVSA-N |
| XLogP | 6.18 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.34 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|