C23H17Cl2NO5 — CID 23472059
2-(2,4-dichlorophenoxy)-N-(5-methoxy-9-oxoxanthen-3-yl)propanamide (PubChem CID 23472059) has the molecular formula C23H17Cl2NO5 and a molecular weight of 458.30 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-(5-methoxy-9-oxoxanthen-3-yl)propanamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-(5-methoxy-9-oxoxanthen-3-yl)propanamide |
|---|---|
| PubChem CID | 23472059 |
| Molecular Formula | C23H17Cl2NO5 |
| Molecular Weight | 458.30 g/mol |
| Exact Mass | 457.05 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-(5-methoxy-9-oxoxanthen-3-yl)propanamide |
| SMILES | COc1cccc2c(=O)c3ccc(NC(=O)C(C)Oc4ccc(Cl)cc4Cl)cc3oc12 |
| InChI | InChI=1S/C23H17Cl2NO5/c1-12(30-18-9-6-13(24)10-17(18)25)23(28)26-14-7-8-15-20(11-14)31-22-16(21(15)27)4-3-5-19(22)29-2/h3-12H,1-2H3,(H,26,28) |
| InChIKey | UKIIJABPKWGCQO-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.30 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|