C32H22N2O6 — CID 2958483
N-[2-methoxy-4-[[4-(2-oxochromen-3-yl)benzoyl]amino]phenyl]-1-benzofuran-2-carboxamide (PubChem CID 2958483) has the molecular formula C32H22N2O6 and a molecular weight of 530.54 g/mol. Its IUPAC name is N-[2-methoxy-4-[[4-(2-oxochromen-3-yl)benzoyl]amino]phenyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[2-methoxy-4-[[4-(2-oxochromen-3-yl)benzoyl]amino]phenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 2958483 |
| Molecular Formula | C32H22N2O6 |
| Molecular Weight | 530.54 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | N-[2-methoxy-4-[[4-(2-oxochromen-3-yl)benzoyl]amino]phenyl]-1-benzofuran-2-carboxamide |
| SMILES | COc1cc(NC(=O)c2ccc(-c3cc4ccccc4oc3=O)cc2)ccc1NC(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C32H22N2O6/c1-38-28-18-23(14-15-25(28)34-31(36)29-17-22-7-3-4-8-26(22)39-29)33-30(35)20-12-10-19(11-13-20)24-16-21-6-2-5-9-27(21)40-32(24)37/h2-18H,1H3,(H,33,35)(H,34,36) |
| InChIKey | WUGNZJZKRNOVNT-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 110.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.54 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|