C22H17N3O4 — CID 1227074
N-[4-(1-benzofuran-2-carbonylamino)-3-methoxyphenyl]pyridine-3-carboxamide (PubChem CID 1227074) has the molecular formula C22H17N3O4 and a molecular weight of 387.40 g/mol. Its IUPAC name is N-[4-(1-benzofuran-2-carbonylamino)-3-methoxyphenyl]pyridine-3-carboxamide.
| Compound Name | N-[4-(1-benzofuran-2-carbonylamino)-3-methoxyphenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 1227074 |
| Molecular Formula | C22H17N3O4 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | N-[4-(1-benzofuran-2-carbonylamino)-3-methoxyphenyl]pyridine-3-carboxamide |
| SMILES | COc1cc(NC(=O)c2cccnc2)ccc1NC(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C22H17N3O4/c1-28-19-12-16(24-21(26)15-6-4-10-23-13-15)8-9-17(19)25-22(27)20-11-14-5-2-3-7-18(14)29-20/h2-13H,1H3,(H,24,26)(H,25,27) |
| InChIKey | OGNDRUPSJFACQO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |