C26H22N4O4 — CID 2852997
N-[2-methoxy-4-[3-methoxy-4-(pyridine-3-carbonylamino)phenyl]phenyl]pyridine-3-carboxamide (PubChem CID 2852997) has the molecular formula C26H22N4O4 and a molecular weight of 454.49 g/mol. Its IUPAC name is N-[2-methoxy-4-[3-methoxy-4-(pyridine-3-carbonylamino)phenyl]phenyl]pyridine-3-carboxamide.
| Compound Name | N-[2-methoxy-4-[3-methoxy-4-(pyridine-3-carbonylamino)phenyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 2852997 |
| Molecular Formula | C26H22N4O4 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | N-[2-methoxy-4-[3-methoxy-4-(pyridine-3-carbonylamino)phenyl]phenyl]pyridine-3-carboxamide |
| SMILES | COc1cc(-c2ccc(NC(=O)c3cccnc3)c(OC)c2)ccc1NC(=O)c1cccnc1 |
| InChI | InChI=1S/C26H22N4O4/c1-33-23-13-17(7-9-21(23)29-25(31)19-5-3-11-27-15-19)18-8-10-22(24(14-18)34-2)30-26(32)20-6-4-12-28-16-20/h3-16H,1-2H3,(H,29,31)(H,30,32) |
| InChIKey | NGRWCATZNLCGAW-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |