C21H17N3O3 — CID 155019311
N-[2-cyano-3-(3,4-dimethoxyphenyl)phenyl]pyridine-3-carboxamide (PubChem CID 155019311) has the molecular formula C21H17N3O3 and a molecular weight of 359.39 g/mol. Its IUPAC name is N-[2-cyano-3-(3,4-dimethoxyphenyl)phenyl]pyridine-3-carboxamide.
| Compound Name | N-[2-cyano-3-(3,4-dimethoxyphenyl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 155019311 |
| Molecular Formula | C21H17N3O3 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | N-[2-cyano-3-(3,4-dimethoxyphenyl)phenyl]pyridine-3-carboxamide |
| SMILES | COc1ccc(-c2cccc(NC(=O)c3cccnc3)c2C#N)cc1OC |
| InChI | InChI=1S/C21H17N3O3/c1-26-19-9-8-14(11-20(19)27-2)16-6-3-7-18(17(16)12-22)24-21(25)15-5-4-10-23-13-15/h3-11,13H,1-2H3,(H,24,25) |
| InChIKey | SUBYJLOMLRWIIQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |