C22H21N3O3S — CID 33491810
N-[2-methoxy-4-[[2-(4-methylphenyl)sulfanylacetyl]amino]phenyl]pyridine-3-carboxamide (PubChem CID 33491810) has the molecular formula C22H21N3O3S and a molecular weight of 407.50 g/mol. Its IUPAC name is N-[2-methoxy-4-[[2-(4-methylphenyl)sulfanylacetyl]amino]phenyl]pyridine-3-carboxamide.
| Compound Name | N-[2-methoxy-4-[[2-(4-methylphenyl)sulfanylacetyl]amino]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 33491810 |
| Molecular Formula | C22H21N3O3S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | N-[2-methoxy-4-[[2-(4-methylphenyl)sulfanylacetyl]amino]phenyl]pyridine-3-carboxamide |
| SMILES | COc1cc(NC(=O)CSc2ccc(C)cc2)ccc1NC(=O)c1cccnc1 |
| InChI | InChI=1S/C22H21N3O3S/c1-15-5-8-18(9-6-15)29-14-21(26)24-17-7-10-19(20(12-17)28-2)25-22(27)16-4-3-11-23-13-16/h3-13H,14H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | XHHILRDVPSXIGN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |