C24H24N4O4 — CID 33492420
N-[4-(4-benzamidobutanoylamino)-2-methoxyphenyl]pyridine-3-carboxamide (PubChem CID 33492420) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is N-[4-(4-benzamidobutanoylamino)-2-methoxyphenyl]pyridine-3-carboxamide.
| Compound Name | N-[4-(4-benzamidobutanoylamino)-2-methoxyphenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 33492420 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | N-[4-(4-benzamidobutanoylamino)-2-methoxyphenyl]pyridine-3-carboxamide |
| SMILES | COc1cc(NC(=O)CCCNC(=O)c2ccccc2)ccc1NC(=O)c1cccnc1 |
| InChI | InChI=1S/C24H24N4O4/c1-32-21-15-19(11-12-20(21)28-24(31)18-9-5-13-25-16-18)27-22(29)10-6-14-26-23(30)17-7-3-2-4-8-17/h2-5,7-9,11-13,15-16H,6,10,14H2,1H3,(H,26,30)(H,27,29)(H,28,31) |
| InChIKey | HMZAZNHDNHGTGD-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|