C22H12Cl3NO3 — CID 4695361
4-(2-oxochromen-3-yl)-N-(2,4,5-trichlorophenyl)benzamide (PubChem CID 4695361) has the molecular formula C22H12Cl3NO3 and a molecular weight of 444.70 g/mol. Its IUPAC name is 4-(2-oxochromen-3-yl)-N-(2,4,5-trichlorophenyl)benzamide.
| Compound Name | 4-(2-oxochromen-3-yl)-N-(2,4,5-trichlorophenyl)benzamide |
|---|---|
| PubChem CID | 4695361 |
| Molecular Formula | C22H12Cl3NO3 |
| Molecular Weight | 444.70 g/mol |
| Exact Mass | 442.99 |
| IUPAC Name | 4-(2-oxochromen-3-yl)-N-(2,4,5-trichlorophenyl)benzamide |
| SMILES | O=C(Nc1cc(Cl)c(Cl)cc1Cl)c1ccc(-c2cc3ccccc3oc2=O)cc1 |
| InChI | InChI=1S/C22H12Cl3NO3/c23-16-10-18(25)19(11-17(16)24)26-21(27)13-7-5-12(6-8-13)15-9-14-3-1-2-4-20(14)29-22(15)28/h1-11H,(H,26,27) |
| InChIKey | CFWQXGPDLDVRCY-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.70 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|