C25H21NO3 — CID 3893067
4-(2-oxochromen-3-yl)-N-(2,4,6-trimethylphenyl)benzamide (PubChem CID 3893067) has the molecular formula C25H21NO3 and a molecular weight of 383.45 g/mol. Its IUPAC name is 4-(2-oxochromen-3-yl)-N-(2,4,6-trimethylphenyl)benzamide.
| Compound Name | 4-(2-oxochromen-3-yl)-N-(2,4,6-trimethylphenyl)benzamide |
|---|---|
| PubChem CID | 3893067 |
| Molecular Formula | C25H21NO3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 4-(2-oxochromen-3-yl)-N-(2,4,6-trimethylphenyl)benzamide |
| SMILES | Cc1cc(C)c(NC(=O)c2ccc(-c3cc4ccccc4oc3=O)cc2)c(C)c1 |
| InChI | InChI=1S/C25H21NO3/c1-15-12-16(2)23(17(3)13-15)26-24(27)19-10-8-18(9-11-19)21-14-20-6-4-5-7-22(20)29-25(21)28/h4-14H,1-3H3,(H,26,27) |
| InChIKey | ICCAMZZAWDHQHN-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|