C31H22N2O4 — CID 3637039
N-[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]-4-(2-oxochromen-3-yl)benzamide (PubChem CID 3637039) has the molecular formula C31H22N2O4 and a molecular weight of 486.53 g/mol. Its IUPAC name is N-[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]-4-(2-oxochromen-3-yl)benzamide.
| Compound Name | N-[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]-4-(2-oxochromen-3-yl)benzamide |
|---|---|
| PubChem CID | 3637039 |
| Molecular Formula | C31H22N2O4 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | N-[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]-4-(2-oxochromen-3-yl)benzamide |
| SMILES | Cc1cc(C)c2oc(-c3cccc(NC(=O)c4ccc(-c5cc6ccccc6oc5=O)cc4)c3)nc2c1 |
| InChI | InChI=1S/C31H22N2O4/c1-18-14-19(2)28-26(15-18)33-30(37-28)23-7-5-8-24(16-23)32-29(34)21-12-10-20(11-13-21)25-17-22-6-3-4-9-27(22)36-31(25)35/h3-17H,1-2H3,(H,32,34) |
| InChIKey | POLFNYYVTRXAMC-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|