C29H19N3O3 — CID 4655949
N-[3-(1H-benzimidazol-2-yl)phenyl]-4-(2-oxochromen-3-yl)benzamide (PubChem CID 4655949) has the molecular formula C29H19N3O3 and a molecular weight of 457.49 g/mol. Its IUPAC name is N-[3-(1H-benzimidazol-2-yl)phenyl]-4-(2-oxochromen-3-yl)benzamide.
| Compound Name | N-[3-(1H-benzimidazol-2-yl)phenyl]-4-(2-oxochromen-3-yl)benzamide |
|---|---|
| PubChem CID | 4655949 |
| Molecular Formula | C29H19N3O3 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | N-[3-(1H-benzimidazol-2-yl)phenyl]-4-(2-oxochromen-3-yl)benzamide |
| SMILES | O=C(Nc1cccc(-c2nc3ccccc3[nH]2)c1)c1ccc(-c2cc3ccccc3oc2=O)cc1 |
| InChI | InChI=1S/C29H19N3O3/c33-28(30-22-8-5-7-21(16-22)27-31-24-9-2-3-10-25(24)32-27)19-14-12-18(13-15-19)23-17-20-6-1-4-11-26(20)35-29(23)34/h1-17H,(H,30,33)(H,31,32) |
| InChIKey | OQVSFZKENQFDGR-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|