C22H17N3O4 — CID 3106201
N-[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]-3-nitrobenzamide (PubChem CID 3106201) has the molecular formula C22H17N3O4 and a molecular weight of 387.40 g/mol. Its IUPAC name is N-[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]-3-nitrobenzamide.
| Compound Name | N-[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 3106201 |
| Molecular Formula | C22H17N3O4 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | N-[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]-3-nitrobenzamide |
| SMILES | Cc1cc(C)c2oc(-c3cccc(NC(=O)c4cccc([N+](=O)[O-])c4)c3)nc2c1 |
| InChI | InChI=1S/C22H17N3O4/c1-13-9-14(2)20-19(10-13)24-22(29-20)16-6-3-7-17(11-16)23-21(26)15-5-4-8-18(12-15)25(27)28/h3-12H,1-2H3,(H,23,26) |
| InChIKey | DQWYTNHABWUBJY-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|