C27H20N2O2 — CID 3125064
N-[3-(6-methyl-1,3-benzoxazol-2-yl)phenyl]-4-phenylbenzamide (PubChem CID 3125064) has the molecular formula C27H20N2O2 and a molecular weight of 404.47 g/mol. Its IUPAC name is N-[3-(6-methyl-1,3-benzoxazol-2-yl)phenyl]-4-phenylbenzamide.
| Compound Name | N-[3-(6-methyl-1,3-benzoxazol-2-yl)phenyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 3125064 |
| Molecular Formula | C27H20N2O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | N-[3-(6-methyl-1,3-benzoxazol-2-yl)phenyl]-4-phenylbenzamide |
| SMILES | Cc1ccc2nc(-c3cccc(NC(=O)c4ccc(-c5ccccc5)cc4)c3)oc2c1 |
| InChI | InChI=1S/C27H20N2O2/c1-18-10-15-24-25(16-18)31-27(29-24)22-8-5-9-23(17-22)28-26(30)21-13-11-20(12-14-21)19-6-3-2-4-7-19/h2-17H,1H3,(H,28,30) |
| InChIKey | MKOHGNHRTVGCFS-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |