C30H17NO5 — CID 3707397
N-(9,10-dioxoanthracen-1-yl)-4-(2-oxochromen-3-yl)benzamide (PubChem CID 3707397) has the molecular formula C30H17NO5 and a molecular weight of 471.47 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-1-yl)-4-(2-oxochromen-3-yl)benzamide.
| Compound Name | N-(9,10-dioxoanthracen-1-yl)-4-(2-oxochromen-3-yl)benzamide |
|---|---|
| PubChem CID | 3707397 |
| Molecular Formula | C30H17NO5 |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | N-(9,10-dioxoanthracen-1-yl)-4-(2-oxochromen-3-yl)benzamide |
| SMILES | O=C(Nc1cccc2c1C(=O)c1ccccc1C2=O)c1ccc(-c2cc3ccccc3oc2=O)cc1 |
| InChI | InChI=1S/C30H17NO5/c32-27-20-7-2-3-8-21(20)28(33)26-22(27)9-5-10-24(26)31-29(34)18-14-12-17(13-15-18)23-16-19-6-1-4-11-25(19)36-30(23)35/h1-16H,(H,31,34) |
| InChIKey | PTHPIOWISUMDST-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|