C28H18N2O4 — CID 2839734
N-(8-benzamido-9,10-dioxoanthracen-1-yl)benzamide (PubChem CID 2839734) has the molecular formula C28H18N2O4 and a molecular weight of 446.46 g/mol. Its IUPAC name is N-(8-benzamido-9,10-dioxoanthracen-1-yl)benzamide.
| Compound Name | N-(8-benzamido-9,10-dioxoanthracen-1-yl)benzamide |
|---|---|
| PubChem CID | 2839734 |
| Molecular Formula | C28H18N2O4 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | N-(8-benzamido-9,10-dioxoanthracen-1-yl)benzamide |
| SMILES | O=C(Nc1cccc2c1C(=O)c1c(NC(=O)c3ccccc3)cccc1C2=O)c1ccccc1 |
| InChI | InChI=1S/C28H18N2O4/c31-25-19-13-7-15-21(29-27(33)17-9-3-1-4-10-17)23(19)26(32)24-20(25)14-8-16-22(24)30-28(34)18-11-5-2-6-12-18/h1-16H,(H,29,33)(H,30,34) |
| InChIKey | MHIIKMFLEZGYPH-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|