C29H15NO5 — CID 3343697
N-(9,10-dioxoanthracen-1-yl)-9,10-dioxoanthracene-1-carboxamide (PubChem CID 3343697) has the molecular formula C29H15NO5 and a molecular weight of 457.44 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-1-yl)-9,10-dioxoanthracene-1-carboxamide.
| Compound Name | N-(9,10-dioxoanthracen-1-yl)-9,10-dioxoanthracene-1-carboxamide |
|---|---|
| PubChem CID | 3343697 |
| Molecular Formula | C29H15NO5 |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | N-(9,10-dioxoanthracen-1-yl)-9,10-dioxoanthracene-1-carboxamide |
| SMILES | O=C1c2ccccc2C(=O)c2c(NC(=O)c3cccc4c3C(=O)c3ccccc3C4=O)cccc21 |
| InChI | InChI=1S/C29H15NO5/c31-25-15-7-1-3-9-17(15)27(33)23-19(25)11-5-13-21(23)29(35)30-22-14-6-12-20-24(22)28(34)18-10-4-2-8-16(18)26(20)32/h1-14H,(H,30,35) |
| InChIKey | DVAODZZIWVTFRE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|