C16H11NO3 — CID 71365214
N-methyl-9,10-dioxoanthracene-1-carboxamide (PubChem CID 71365214) has the molecular formula C16H11NO3 and a molecular weight of 265.27 g/mol. Its IUPAC name is N-methyl-9,10-dioxoanthracene-1-carboxamide.
| Compound Name | N-methyl-9,10-dioxoanthracene-1-carboxamide |
|---|---|
| PubChem CID | 71365214 |
| Molecular Formula | C16H11NO3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | N-methyl-9,10-dioxoanthracene-1-carboxamide |
| SMILES | CNC(=O)c1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C16H11NO3/c1-17-16(20)12-8-4-7-11-13(12)15(19)10-6-3-2-5-9(10)14(11)18/h2-8H,1H3,(H,17,20) |
| InChIKey | AJBDIXANZYGTNY-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|