C24H22N2O8S2 — CID 102415408
methyl (2R)-2-[[8-[[(2R)-1-methoxy-1-oxo-3-sulfanylpropan-2-yl]carbamoyl]-9,10-dioxoanthracene-1-carbonyl]amino]-3-sulfanylpropanoate (PubChem CID 102415408) has the molecular formula C24H22N2O8S2 and a molecular weight of 530.58 g/mol. Its IUPAC name is methyl (2R)-2-[[8-[[(2R)-1-methoxy-1-oxo-3-sulfanylpropan-2-yl]carbamoyl]-9,10-dioxoanthracene-1-carbonyl]amino]-3-sulfanylpropanoate.
| Compound Name | methyl (2R)-2-[[8-[[(2R)-1-methoxy-1-oxo-3-sulfanylpropan-2-yl]carbamoyl]-9,10-dioxoanthracene-1-carbonyl]amino]-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 102415408 |
| Molecular Formula | C24H22N2O8S2 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.08 |
| IUPAC Name | methyl (2R)-2-[[8-[[(2R)-1-methoxy-1-oxo-3-sulfanylpropan-2-yl]carbamoyl]-9,10-dioxoanthracene-1-carbonyl]amino]-3-sulfanylpropanoate |
| SMILES | COC(=O)[C@H](CS)NC(=O)c1cccc2c1C(=O)c1c(C(=O)N[C@@H](CS)C(=O)OC)cccc1C2=O |
| InChI | InChI=1S/C24H22N2O8S2/c1-33-23(31)15(9-35)25-21(29)13-7-3-5-11-17(13)20(28)18-12(19(11)27)6-4-8-14(18)22(30)26-16(10-36)24(32)34-2/h3-8,15-16,35-36H,9-10H2,1-2H3,(H,25,29)(H,26,30)/t15-,16-/m0/s1 |
| InChIKey | IVGDWEYRFMWHNT-HOTGVXAUSA-N |
| XLogP | 0.86 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|