C16H11NO4 — CID 70123121
methyl 8-amino-9,10-dioxoanthracene-1-carboxylate (PubChem CID 70123121) has the molecular formula C16H11NO4 and a molecular weight of 281.27 g/mol. Its IUPAC name is methyl 8-amino-9,10-dioxoanthracene-1-carboxylate.
| Compound Name | methyl 8-amino-9,10-dioxoanthracene-1-carboxylate |
|---|---|
| PubChem CID | 70123121 |
| Molecular Formula | C16H11NO4 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | methyl 8-amino-9,10-dioxoanthracene-1-carboxylate |
| SMILES | COC(=O)c1cccc2c1C(=O)c1c(N)cccc1C2=O |
| InChI | InChI=1S/C16H11NO4/c1-21-16(20)10-6-2-4-8-12(10)15(19)13-9(14(8)18)5-3-7-11(13)17/h2-7H,17H2,1H3 |
| InChIKey | CZYCKGNAXVPDLZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|