C19H11ClO8 — CID 67738968
1-chloro-4,5-bis(methoxycarbonyl)-9,10-dioxoanthracene-2-carboxylic acid (PubChem CID 67738968) has the molecular formula C19H11ClO8 and a molecular weight of 402.74 g/mol. Its IUPAC name is 1-chloro-4,5-bis(methoxycarbonyl)-9,10-dioxoanthracene-2-carboxylic acid.
| Compound Name | 1-chloro-4,5-bis(methoxycarbonyl)-9,10-dioxoanthracene-2-carboxylic acid |
|---|---|
| PubChem CID | 67738968 |
| Molecular Formula | C19H11ClO8 |
| Molecular Weight | 402.74 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | 1-chloro-4,5-bis(methoxycarbonyl)-9,10-dioxoanthracene-2-carboxylic acid |
| SMILES | COC(=O)c1cccc2c1C(=O)c1c(C(=O)OC)cc(C(=O)O)c(Cl)c1C2=O |
| InChI | InChI=1S/C19H11ClO8/c1-27-18(25)8-5-3-4-7-11(8)16(22)12-9(19(26)28-2)6-10(17(23)24)14(20)13(12)15(7)21/h3-6H,1-2H3,(H,23,24) |
| InChIKey | ATCWHCGGCUSMAR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.74 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|