C20H14ClNO6S — CID 70278658
methyl (2S)-3-(4-chlorophenyl)-2-[(2,3,4-trioxothiochromene-8-carbonyl)amino]propanoate (PubChem CID 70278658) has the molecular formula C20H14ClNO6S and a molecular weight of 431.85 g/mol. Its IUPAC name is methyl (2S)-3-(4-chlorophenyl)-2-[(2,3,4-trioxothiochromene-8-carbonyl)amino]propanoate.
| Compound Name | methyl (2S)-3-(4-chlorophenyl)-2-[(2,3,4-trioxothiochromene-8-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 70278658 |
| Molecular Formula | C20H14ClNO6S |
| Molecular Weight | 431.85 g/mol |
| Exact Mass | 431.02 |
| IUPAC Name | methyl (2S)-3-(4-chlorophenyl)-2-[(2,3,4-trioxothiochromene-8-carbonyl)amino]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(Cl)cc1)NC(=O)c1cccc2c1SC(=O)C(=O)C2=O |
| InChI | InChI=1S/C20H14ClNO6S/c1-28-19(26)14(9-10-5-7-11(21)8-6-10)22-18(25)13-4-2-3-12-15(23)16(24)20(27)29-17(12)13/h2-8,14H,9H2,1H3,(H,22,25)/t14-/m0/s1 |
| InChIKey | CXNIUYJSUFUWIA-AWEZNQCLSA-N |
| XLogP | 2.24 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.85 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|