C23H21ClN2O4 — CID 68866789
methyl (2S)-2-[(2-amino-5-chlorobenzoyl)amino]-3-[4-(3-hydroxyphenyl)phenyl]propanoate (PubChem CID 68866789) has the molecular formula C23H21ClN2O4 and a molecular weight of 424.88 g/mol. Its IUPAC name is methyl (2S)-2-[(2-amino-5-chlorobenzoyl)amino]-3-[4-(3-hydroxyphenyl)phenyl]propanoate.
| Compound Name | methyl (2S)-2-[(2-amino-5-chlorobenzoyl)amino]-3-[4-(3-hydroxyphenyl)phenyl]propanoate |
|---|---|
| PubChem CID | 68866789 |
| Molecular Formula | C23H21ClN2O4 |
| Molecular Weight | 424.88 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | methyl (2S)-2-[(2-amino-5-chlorobenzoyl)amino]-3-[4-(3-hydroxyphenyl)phenyl]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(-c2cccc(O)c2)cc1)NC(=O)c1cc(Cl)ccc1N |
| InChI | InChI=1S/C23H21ClN2O4/c1-30-23(29)21(26-22(28)19-13-17(24)9-10-20(19)25)11-14-5-7-15(8-6-14)16-3-2-4-18(27)12-16/h2-10,12-13,21,27H,11,25H2,1H3,(H,26,28)/t21-/m0/s1 |
| InChIKey | RPCMTCSZSXVLPY-NRFANRHFSA-N |
| XLogP | 3.81 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.88 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|