C29H24N2O6 — CID 58717845
methyl (2S)-2-[[2-hydroxy-5-(3-nitrophenyl)benzoyl]amino]-3-(4-phenylphenyl)propanoate (PubChem CID 58717845) has the molecular formula C29H24N2O6 and a molecular weight of 496.52 g/mol. Its IUPAC name is methyl (2S)-2-[[2-hydroxy-5-(3-nitrophenyl)benzoyl]amino]-3-(4-phenylphenyl)propanoate.
| Compound Name | methyl (2S)-2-[[2-hydroxy-5-(3-nitrophenyl)benzoyl]amino]-3-(4-phenylphenyl)propanoate |
|---|---|
| PubChem CID | 58717845 |
| Molecular Formula | C29H24N2O6 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | methyl (2S)-2-[[2-hydroxy-5-(3-nitrophenyl)benzoyl]amino]-3-(4-phenylphenyl)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(-c2ccccc2)cc1)NC(=O)c1cc(-c2cccc([N+](=O)[O-])c2)ccc1O |
| InChI | InChI=1S/C29H24N2O6/c1-37-29(34)26(16-19-10-12-21(13-11-19)20-6-3-2-4-7-20)30-28(33)25-18-23(14-15-27(25)32)22-8-5-9-24(17-22)31(35)36/h2-15,17-18,26,32H,16H2,1H3,(H,30,33)/t26-/m0/s1 |
| InChIKey | DBIKSDNEORSDOY-SANMLTNESA-N |
| XLogP | 5.15 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|