C31H25F3N2O6 — CID 67555968
2-hydroxy-N-[(2S)-4-hydroxy-1-[4-(3-nitrophenyl)phenyl]-3-oxopentan-2-yl]-5-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 67555968) has the molecular formula C31H25F3N2O6 and a molecular weight of 578.54 g/mol. Its IUPAC name is 2-hydroxy-N-[(2S)-4-hydroxy-1-[4-(3-nitrophenyl)phenyl]-3-oxopentan-2-yl]-5-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 2-hydroxy-N-[(2S)-4-hydroxy-1-[4-(3-nitrophenyl)phenyl]-3-oxopentan-2-yl]-5-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 67555968 |
| Molecular Formula | C31H25F3N2O6 |
| Molecular Weight | 578.54 g/mol |
| Exact Mass | 578.17 |
| IUPAC Name | 2-hydroxy-N-[(2S)-4-hydroxy-1-[4-(3-nitrophenyl)phenyl]-3-oxopentan-2-yl]-5-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | CC(O)C(=O)[C@H](Cc1ccc(-c2cccc([N+](=O)[O-])c2)cc1)NC(=O)c1cc(-c2cccc(C(F)(F)F)c2)ccc1O |
| InChI | InChI=1S/C31H25F3N2O6/c1-18(37)29(39)27(14-19-8-10-20(11-9-19)22-5-3-7-25(16-22)36(41)42)35-30(40)26-17-23(12-13-28(26)38)21-4-2-6-24(15-21)31(32,33)34/h2-13,15-18,27,37-38H,14H2,1H3,(H,35,40)/t18?,27-/m0/s1 |
| InChIKey | MLTNUDBBVUQJER-UEEDVJNSSA-N |
| XLogP | 5.94 |
| TPSA | 129.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.54 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|