C38H31F3N2O5 — CID 59852556
methyl (2S)-2-[[2-hydroxy-5-[[2-[3-[4-(trifluoromethyl)phenyl]phenyl]acetyl]amino]benzoyl]amino]-3-(4-phenylphenyl)propanoate (PubChem CID 59852556) has the molecular formula C38H31F3N2O5 and a molecular weight of 652.67 g/mol. Its IUPAC name is methyl (2S)-2-[[2-hydroxy-5-[[2-[3-[4-(trifluoromethyl)phenyl]phenyl]acetyl]amino]benzoyl]amino]-3-(4-phenylphenyl)propanoate.
| Compound Name | methyl (2S)-2-[[2-hydroxy-5-[[2-[3-[4-(trifluoromethyl)phenyl]phenyl]acetyl]amino]benzoyl]amino]-3-(4-phenylphenyl)propanoate |
|---|---|
| PubChem CID | 59852556 |
| Molecular Formula | C38H31F3N2O5 |
| Molecular Weight | 652.67 g/mol |
| Exact Mass | 652.22 |
| IUPAC Name | methyl (2S)-2-[[2-hydroxy-5-[[2-[3-[4-(trifluoromethyl)phenyl]phenyl]acetyl]amino]benzoyl]amino]-3-(4-phenylphenyl)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(-c2ccccc2)cc1)NC(=O)c1cc(NC(=O)Cc2cccc(-c3ccc(C(F)(F)F)cc3)c2)ccc1O |
| InChI | InChI=1S/C38H31F3N2O5/c1-48-37(47)33(21-24-10-12-27(13-11-24)26-7-3-2-4-8-26)43-36(46)32-23-31(18-19-34(32)44)42-35(45)22-25-6-5-9-29(20-25)28-14-16-30(17-15-28)38(39,40)41/h2-20,23,33,44H,21-22H2,1H3,(H,42,45)(H,43,46)/t33-/m0/s1 |
| InChIKey | UODTVBNTOUAPTK-XIFFEERXSA-N |
| XLogP | 7.44 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.67 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|