C29H22F3NO3 — CID 58718027
(2S)-3-(4-phenylphenyl)-2-[[4-[3-(trifluoromethyl)phenyl]benzoyl]amino]propanoic acid (PubChem CID 58718027) has the molecular formula C29H22F3NO3 and a molecular weight of 489.49 g/mol. Its IUPAC name is (2S)-3-(4-phenylphenyl)-2-[[4-[3-(trifluoromethyl)phenyl]benzoyl]amino]propanoic acid.
| Compound Name | (2S)-3-(4-phenylphenyl)-2-[[4-[3-(trifluoromethyl)phenyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 58718027 |
| Molecular Formula | C29H22F3NO3 |
| Molecular Weight | 489.49 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | (2S)-3-(4-phenylphenyl)-2-[[4-[3-(trifluoromethyl)phenyl]benzoyl]amino]propanoic acid |
| SMILES | O=C(N[C@@H](Cc1ccc(-c2ccccc2)cc1)C(=O)O)c1ccc(-c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C29H22F3NO3/c30-29(31,32)25-8-4-7-24(18-25)22-13-15-23(16-14-22)27(34)33-26(28(35)36)17-19-9-11-21(12-10-19)20-5-2-1-3-6-20/h1-16,18,26H,17H2,(H,33,34)(H,35,36)/t26-/m0/s1 |
| InChIKey | HTJQZNNGNRVZSF-SANMLTNESA-N |
| XLogP | 6.47 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.49 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |