C16H14BrClN2O3 — CID 18422774
2-[(2-amino-5-bromobenzoyl)amino]-3-(4-chlorophenyl)propanoic acid (PubChem CID 18422774) has the molecular formula C16H14BrClN2O3 and a molecular weight of 397.66 g/mol. Its IUPAC name is 2-[(2-amino-5-bromobenzoyl)amino]-3-(4-chlorophenyl)propanoic acid.
| Compound Name | 2-[(2-amino-5-bromobenzoyl)amino]-3-(4-chlorophenyl)propanoic acid |
|---|---|
| PubChem CID | 18422774 |
| Molecular Formula | C16H14BrClN2O3 |
| Molecular Weight | 397.66 g/mol |
| Exact Mass | 395.99 |
| IUPAC Name | 2-[(2-amino-5-bromobenzoyl)amino]-3-(4-chlorophenyl)propanoic acid |
| SMILES | Nc1ccc(Br)cc1C(=O)NC(Cc1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C16H14BrClN2O3/c17-10-3-6-13(19)12(8-10)15(21)20-14(16(22)23)7-9-1-4-11(18)5-2-9/h1-6,8,14H,7,19H2,(H,20,21)(H,22,23) |
| InChIKey | VAIYZIYKGSFYHA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.66 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|