C18H19ClN2O3 — CID 175869880
(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-(4-chlorophenyl)propanoic acid (PubChem CID 175869880) has the molecular formula C18H19ClN2O3 and a molecular weight of 346.81 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-(4-chlorophenyl)propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-(4-chlorophenyl)propanoic acid |
|---|---|
| PubChem CID | 175869880 |
| Molecular Formula | C18H19ClN2O3 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-(4-chlorophenyl)propanoic acid |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C18H19ClN2O3/c19-14-8-6-13(7-9-14)11-16(18(23)24)21-17(22)15(20)10-12-4-2-1-3-5-12/h1-9,15-16H,10-11,20H2,(H,21,22)(H,23,24)/t15-,16-/m0/s1 |
| InChIKey | NEHQLSBEDJLJAO-HOTGVXAUSA-N |
| XLogP | 2.02 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |