C15H21ClN2O3 — CID 175961360
(2S)-2-[[(2S)-2-amino-3-(4-chlorophenyl)propanoyl]amino]-4-methylpentanoic acid (PubChem CID 175961360) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-amino-3-(4-chlorophenyl)propanoyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-amino-3-(4-chlorophenyl)propanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 175961360 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-3-(4-chlorophenyl)propanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](N)Cc1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C15H21ClN2O3/c1-9(2)7-13(15(20)21)18-14(19)12(17)8-10-3-5-11(16)6-4-10/h3-6,9,12-13H,7-8,17H2,1-2H3,(H,18,19)(H,20,21)/t12-,13-/m0/s1 |
| InChIKey | OZQXNZIWRPCFKQ-STQMWFEESA-N |
| XLogP | 1.83 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |