C15H21N2O4- — CID 102185128
4-[(2S)-2-amino-3-[[(1S)-1-carboxy-3-methylbutyl]amino]-3-oxopropyl]phenolate (PubChem CID 102185128) has the molecular formula C15H21N2O4- and a molecular weight of 293.34 g/mol. Its IUPAC name is 4-[(2S)-2-amino-3-[[(1S)-1-carboxy-3-methylbutyl]amino]-3-oxopropyl]phenolate.
| Compound Name | 4-[(2S)-2-amino-3-[[(1S)-1-carboxy-3-methylbutyl]amino]-3-oxopropyl]phenolate |
|---|---|
| PubChem CID | 102185128 |
| Molecular Formula | C15H21N2O4- |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 4-[(2S)-2-amino-3-[[(1S)-1-carboxy-3-methylbutyl]amino]-3-oxopropyl]phenolate |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](N)Cc1ccc([O-])cc1)C(=O)O |
| InChI | InChI=1S/C15H22N2O4/c1-9(2)7-13(15(20)21)17-14(19)12(16)8-10-3-5-11(18)6-4-10/h3-6,9,12-13,18H,7-8,16H2,1-2H3,(H,17,19)(H,20,21)/p-1/t12-,13-/m0/s1 |
| InChIKey | AUEJLPRZGVVDNU-STQMWFEESA-M |
| XLogP | 0.25 |
| TPSA | 115.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |