C12H17N3O3 — CID 11949370
(2R)-2-[[(2R)-2,3-diaminopropanoyl]amino]-3-phenylpropanoic acid (PubChem CID 11949370) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is (2R)-2-[[(2R)-2,3-diaminopropanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[[(2R)-2,3-diaminopropanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 11949370 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | (2R)-2-[[(2R)-2,3-diaminopropanoyl]amino]-3-phenylpropanoic acid |
| SMILES | NC[C@@H](N)C(=O)N[C@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C12H17N3O3/c13-7-9(14)11(16)15-10(12(17)18)6-8-4-2-1-3-5-8/h1-5,9-10H,6-7,13-14H2,(H,15,16)(H,17,18)/t9-,10-/m1/s1 |
| InChIKey | QXDQIONFEUSGQV-NXEZZACHSA-N |
| XLogP | -0.92 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |