C12H13BrN2O5 — CID 79722795
2-[(2-amino-4-bromobenzoyl)amino]pentanedioic acid (PubChem CID 79722795) has the molecular formula C12H13BrN2O5 and a molecular weight of 345.15 g/mol. Its IUPAC name is 2-[(2-amino-4-bromobenzoyl)amino]pentanedioic acid.
| Compound Name | 2-[(2-amino-4-bromobenzoyl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 79722795 |
| Molecular Formula | C12H13BrN2O5 |
| Molecular Weight | 345.15 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | 2-[(2-amino-4-bromobenzoyl)amino]pentanedioic acid |
| SMILES | Nc1cc(Br)ccc1C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H13BrN2O5/c13-6-1-2-7(8(14)5-6)11(18)15-9(12(19)20)3-4-10(16)17/h1-2,5,9H,3-4,14H2,(H,15,18)(H,16,17)(H,19,20) |
| InChIKey | KAMMOUCHBOBGID-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.15 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|