C12H11BrINO5 — CID 61152876
(2S)-2-[(5-bromo-2-iodobenzoyl)amino]pentanedioic acid (PubChem CID 61152876) has the molecular formula C12H11BrINO5 and a molecular weight of 456.03 g/mol. Its IUPAC name is (2S)-2-[(5-bromo-2-iodobenzoyl)amino]pentanedioic acid.
| Compound Name | (2S)-2-[(5-bromo-2-iodobenzoyl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 61152876 |
| Molecular Formula | C12H11BrINO5 |
| Molecular Weight | 456.03 g/mol |
| Exact Mass | 454.89 |
| IUPAC Name | (2S)-2-[(5-bromo-2-iodobenzoyl)amino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)c1cc(Br)ccc1I)C(=O)O |
| InChI | InChI=1S/C12H11BrINO5/c13-6-1-2-8(14)7(5-6)11(18)15-9(12(19)20)3-4-10(16)17/h1-2,5,9H,3-4H2,(H,15,18)(H,16,17)(H,19,20)/t9-/m0/s1 |
| InChIKey | IDSXTXTXTDSIGP-VIFPVBQESA-N |
| XLogP | 2.10 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.03 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|