C12H11ClINO5 — CID 103218940
2-[(3-chloro-4-iodobenzoyl)amino]pentanedioic acid (PubChem CID 103218940) has the molecular formula C12H11ClINO5 and a molecular weight of 411.58 g/mol. Its IUPAC name is 2-[(3-chloro-4-iodobenzoyl)amino]pentanedioic acid.
| Compound Name | 2-[(3-chloro-4-iodobenzoyl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 103218940 |
| Molecular Formula | C12H11ClINO5 |
| Molecular Weight | 411.58 g/mol |
| Exact Mass | 410.94 |
| IUPAC Name | 2-[(3-chloro-4-iodobenzoyl)amino]pentanedioic acid |
| SMILES | O=C(O)CCC(NC(=O)c1ccc(I)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C12H11ClINO5/c13-7-5-6(1-2-8(7)14)11(18)15-9(12(19)20)3-4-10(16)17/h1-2,5,9H,3-4H2,(H,15,18)(H,16,17)(H,19,20) |
| InChIKey | LOGXCPSTNREECS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.58 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|