C16H15NO5 — CID 54513086
(2S)-2-(naphthalene-2-carbonylamino)pentanedioic acid (PubChem CID 54513086) has the molecular formula C16H15NO5 and a molecular weight of 301.30 g/mol. Its IUPAC name is (2S)-2-(naphthalene-2-carbonylamino)pentanedioic acid.
| Compound Name | (2S)-2-(naphthalene-2-carbonylamino)pentanedioic acid |
|---|---|
| PubChem CID | 54513086 |
| Molecular Formula | C16H15NO5 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | (2S)-2-(naphthalene-2-carbonylamino)pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)c1ccc2ccccc2c1)C(=O)O |
| InChI | InChI=1S/C16H15NO5/c18-14(19)8-7-13(16(21)22)17-15(20)12-6-5-10-3-1-2-4-11(10)9-12/h1-6,9,13H,7-8H2,(H,17,20)(H,18,19)(H,21,22)/t13-/m0/s1 |
| InChIKey | YKNDIAJZDLLIDP-ZDUSSCGKSA-N |
| XLogP | 1.89 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |