C13H15NO6 — CID 60830283
2-[(3-hydroxy-4-methylbenzoyl)amino]pentanedioic acid (PubChem CID 60830283) has the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. Its IUPAC name is 2-[(3-hydroxy-4-methylbenzoyl)amino]pentanedioic acid.
| Compound Name | 2-[(3-hydroxy-4-methylbenzoyl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 60830283 |
| Molecular Formula | C13H15NO6 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 2-[(3-hydroxy-4-methylbenzoyl)amino]pentanedioic acid |
| SMILES | Cc1ccc(C(=O)NC(CCC(=O)O)C(=O)O)cc1O |
| InChI | InChI=1S/C13H15NO6/c1-7-2-3-8(6-10(7)15)12(18)14-9(13(19)20)4-5-11(16)17/h2-3,6,9,15H,4-5H2,1H3,(H,14,18)(H,16,17)(H,19,20) |
| InChIKey | LLAVJQPUKKNBJJ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |